| Identification |
| Name: | Pentacyclo[4.2.0.02,5.03,8.04,7]octane |
| Synonyms: | Cubane;Quadriprismane; [4]Prismane |
| CAS: | 277-10-1 |
| Molecular Formula: | C8H8 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H8/c1-2-5-3(1)7-4(1)6(2)8(5)7/h1-8H |
| Molecular Structure: |
![(C8H8) Cubane;Quadriprismane; [4]Prismane](https://img1.guidechem.com/chem/e/dict/181/277-10-1.jpg) |
| Properties |
| Melting Point: | 125 - 126 C |
| Flash Point: | 7.6°C |
| Boiling Point: | 137.9°C at 760 mmHg |
| Density: | 1.577g/cm3 |
| Stability: | Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.834 |
| Water Solubility: | Stability Combustible. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological ab |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 7.6°C |
| Safety Data |
| |
 |
