| Identification |
| Name: | Benzeneacetic acid,4-hydroxy-, phenylmethyl ester |
| Synonyms: | Aceticacid, (p-hydroxyphenyl)-, benzyl ester (8CI); Benzyl (4-hydroxyphenyl)acetate;Benzyl 2-(4-hydroxyphenyl)acetate; Benzyl p-hydroxyphenylacetate |
| CAS: | 27727-37-3 |
| Molecular Formula: | C15H14 O3 |
| Molecular Weight: | 242.27 |
| InChI: | InChI=1/C15H14O3/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h1-9,16H,10-11H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 166.791°C |
| Boiling Point: | 394.031°C at 760 mmHg |
| Density: | 1.203g/cm3 |
| Refractive index: | 1.597 |
| Flash Point: | 166.791°C |
| Usage: | Intermediate in the preparation of Camostat metabolites. |
| Safety Data |
| |
 |
