Identification |
Name: | Benzeneacetic acid,4-hydroxy-, phenylmethyl ester |
Synonyms: | Aceticacid, (p-hydroxyphenyl)-, benzyl ester (8CI); Benzyl (4-hydroxyphenyl)acetate;Benzyl 2-(4-hydroxyphenyl)acetate; Benzyl p-hydroxyphenylacetate |
CAS: | 27727-37-3 |
Molecular Formula: | C15H14 O3 |
Molecular Weight: | 242.27 |
InChI: | InChI=1/C15H14O3/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h1-9,16H,10-11H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 166.791°C |
Boiling Point: | 394.031°C at 760 mmHg |
Density: | 1.203g/cm3 |
Refractive index: | 1.597 |
Flash Point: | 166.791°C |
Usage: | Intermediate in the preparation of Camostat metabolites. |
Safety Data |
|
 |