Identification |
Name: | 2-Naphthalenol,6-propyl- |
Synonyms: | 2-Naphthol,6-propyl- (6CI,7CI,8CI);2-Hydroxy-6-propylnaphthalene;2-Propyl-6-hydroxynaphthalene;6-Propyl-2-naphthol;6-Propylnaphthalen-2-ol; |
CAS: | 2776-56-9 |
Molecular Formula: | C13H14O |
Molecular Weight: | 186.25 |
InChI: | InChI=1/C13H14O/c1-2-3-10-4-5-12-9-13(14)7-6-11(12)8-10/h4-9,14H,2-3H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 161°C |
Boiling Point: | 335.3°C at 760 mmHg |
Density: | 1.087g/cm3 |
Refractive index: | 1.619 |
Specification: |
6-Propyl-2-naphthol (2776-56-9), which also can be called for 6-Propyl-2-naphthalenol ; 6-propylnaphthalen-2-ol , is naphthalene derivatives. The structure of 6-Propyl-2-naphthol (2776-56-9) is:
|
Flash Point: | 161°C |
Safety Data |
|
 |