| Identification |
| Name: | 2-Butanone,3-ethoxy-1,1-dihydroxy- |
| Synonyms: | 3-Ethoxy-1,1-dihydroxy-2-butanone;3-Ethoxy-2-oxobutyraldehyde hydrate; Kethoxal; Ketoxal; U 2032 |
| CAS: | 27762-78-3 |
| Molecular Formula: | C6H12 O4 |
| Molecular Weight: | 148.15708 |
| InChI: | InChI=1S/C6H12O4/c1-3-10-4(2)5(7)6(8)9/h4,6,8-9H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.168 g/cm3 |
| Refractive index: | 1.458 |
| Water Solubility: | Soluble in ethyl acetate or benzene; miscible with ethanol; very slightly soluble in water |
| Solubility: | Soluble in ethyl acetate or benzene; miscible with ethanol; very slightly soluble in water |
| Appearance: | Clear yellow to orange-yellow liquid |
| Safety Data |
| |
 |
