| Identification | |
| Name: | 2-Nitro-4-aminodiphenylamine |
| Synonyms: | p-Phenylenediamine,2-nitro-N1-phenyl- (7CI,8CI);1-Anilino-4-amino-2-nitrobenzene;2-Nitro-4-amino-N-phenylaniline;4-Amino-2-nitrodiphenylamine;HC Red 1;HC RedNo. 1; |
| CAS: | 2784-89-6 |
| EINECS: | 220-494-3 |
| Molecular Formula: | C12H11N3O2 |
| Molecular Weight: | 229.23 |
| InChI: | InChI=1/C12H11N3O2/c13-9-6-7-11(12(8-9)15(16)17)14-10-4-2-1-3-5-10/h1-8,14H,13H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.351 |
| Refractive index: | 1.711 |
| Appearance: | Green-brown crystal powder |
| Specification: |
2-Nitro-4-aminodiphenylamine , with CAS number of 2784-89-6, can be called 2-Nitro-N(sup 1)-phenyl-1,4-benzenediamine ; 4-Amino-2-nitrodiphenylamine ; p-Phenylenediamine, 2-nitro-N(sup 1)-phenyl- . It is a green-brown crystal powder. |
| Safety Data | |
 |
|
