| Identification | |
| Name: | Propanoic acid,2-hydroxy-, lithium salt (1:1), (2S)- |
| Synonyms: | Lacticacid, monolithium salt, L- (8CI);Propanoic acid, 2-hydroxy-, monolithium salt,(2S)- (9CI);Propanoic acid, 2-hydroxy-, monolithium salt, (S)-;LithiumL(+)-lactate;Lithium L-lactate; |
| CAS: | 27848-80-2 |
| EINECS: | 248-692-5 |
| Molecular Formula: | C3H4O3.Li |
| Molecular Weight: | 96.011 |
| InChI: | InChI=1S/C3H6O3.Li/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Refractive index: | -14 ° (C=5, H2O) |
| Appearance: | white fine crystalline powder |
| Specification: |
L-Lactic acid lithium salt (27848-80-2) is also known as Lithium (S)-lactate ; Lithium-L-lactate with appearance of white fine crystalline powder. It is a kind of building blocks for liquid crystals. |
| Storage Temperature: | -20°C |
| Safety Data | |
 |
|
