| Identification | |
| Name: | 4-ethylguaiacol |
| Synonyms: | 4-Ethyl-2-methoxyphenol; 2-Methoxy-4-ethylphenol |
| CAS: | 2785-89-9 |
| EINECS: | 220-500-4 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C9H12O2/c1-3-7-4-5-8(10)9(6-7)11-2/h4-6,10H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.058 |
| Refractive index: | 1.525-1.53 |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
? Phenol,4-ethyl-2-methoxy-?with cas registry number of 2785-89-9 is also called?4-Ethylguaiacol ; 1-Hydroxy-2-methoxy-4-ethylbenzene ; 2-Methoxy-4-ethylphenol ; 4-Ethyl-2-methoxyphenol ; 4-Hydroxy-3-methoxy ethylbenzene ; 4-Hydroxy-3-methoxyethylbenzene ; 4-Hydroxy-3-methoxyphenylethane ; Guaiacol, 4-ethyl- ; Guaiacyl ethane ; Homocresol ; NSC 82313 ; UNII-C9NFD83BJ5 ; p-Ethylguaiacol . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
