| Identification | |
| Name: | Benzene,1,1'-(1,2-ethynediyl)bis[4-bromo- |
| Synonyms: | Acetylene,bis(p-bromophenyl)- (7CI,8CI);1,2-Bis(4-bromophenyl)ethyne;4,4'-Dibromotolan;4,4'-Dibromotolane;Bis(4-bromophenyl)acetylene;Bis(4-bromophenyl)ethyne;p,p'-Dibromotolan; |
| CAS: | 2789-89-1 |
| Molecular Formula: | C14H8Br2 |
| Molecular Weight: | 336.02 |
| InChI: | InChI=1/C14H8Br2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 182 °C |
| Density: | 1.74 g/cm3 |
| Refractive index: | 1.697 |
| Specification: |
The Bis(4-bromophenyl)acetylene, with the cas registry number 2789-89-1, has the systematic name of 1,1'-ethyne-1,2-diylbis(4-bromobenzene). It is a kind of off-white crystalline powder, and it belongs to the product categories of Aromatic Hydrocarbons (substituted) & Derivatives and Miscellaneous. And the molecular formula of the chemical is C14H8Br2. The characteristics of this chemical are as followings: (1)ACD/LogP: 6.32; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 0 Å2; (7)Index of Refraction: 1.697; (8)Molar Refractivity: 74.17 cm3; (9)Molar Volume: 192.5 cm3; (10)Polarizability: 29.4×10-24cm3; (11)Surface Tension: 60.5 dyne/cm; (12)Density: 1.74 g/cm3; (13)Flash Point: 217.2 °C; (14)Enthalpy of Vaporization: 60.74 kJ/mol; (15)Boiling Point: 383.6 °C at 760 mmHg; (16)Vapour Pressure: 9.62E-06 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
