Identification |
Name: | Benzoic acid,2-hydroxy-, 2-ethoxy-2-oxoethyl ester |
Synonyms: | Salicylicacid, ester with ethyl glycolate (8CI); Glycolic acid, ethyl ester, salicylate(8CI); Salicyloyloxyacetic acid ethyl ester |
CAS: | 27893-14-7 |
EINECS: | 248-713-8 |
Molecular Formula: | C11H12 O5 |
Molecular Weight: | 224.20998 |
InChI: | InChI=1/C11H12O5/c1-2-15-10(13)7-16-11(14)8-5-3-4-6-9(8)12/h3-6,12H,2,7H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 131.5°C |
Boiling Point: | 344°Cat760mmHg |
Density: | 1.254g/cm3 |
Refractive index: | 1.534 |
Flash Point: | 131.5°C |
Safety Data |
|
 |