| Identification | |
| Name: | 1,4-Diazabicyclo[2.2.2]octane |
| Synonyms: | BACO; Dabco; TED; Triethylenediamine; 1,4-Diazabicyclo(2.2.2)octane; dabco 33-lv; 1,4-Diazabicyclo(2,2,2)octane; Dabco(rg~TEDA~Triethylenediamine; Diazabicyclooctane; A-33; 33% triethylenediamine; 25% triethylenediamine (TEDA); TEDA; Triethylene Diamine |
| CAS: | 280-57-9 |
| EINECS: | 205-999-9 |
| Molecular Formula: | C6H12N2 |
| Molecular Weight: | 112.17 |
| InChI: | InChI=1/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.14 |
| Stability: | Stable, but very hygroscopic. Incompatible with strong oxidizing agents, strong acids. Highly flammable. |
| Refractive index: | n20/D 1.4634(lit.) |
| Appearance: | white crystalline powder |
| Specification: |
?1,4-Diazabicyclo(2.2.2)octane , its cas register number is 280-57-9. It also can be called?1,4-Diazabicyclo[2.2.2]octane ; Dabco ; Quinuclidine ; Triethylenediamine ; N,N'-endo-Ethylenepiperazine .It is a white crystalline powder.It?smells like peanuts. |
| Packinggroup: | III |
| HS Code: | 29335920 |
| Sensitive: | Hygroscopic |
| Color: | Colorless hygroscopic crystals |
| Usage: | Catalyst in making urethane foams. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
