| Identification | |
| Name: | 6-Benzofuranethanamine,5-methoxy-, hydrochloride (1:1) |
| Synonyms: | 6-Benzofuranethanamine,5-methoxy-, hydrochloride (9CI) |
| CAS: | 28089-06-7 |
| Molecular Formula: | C11H13 N O2 . Cl H |
| Molecular Weight: | 226.70 |
| InChI: | InChI=1/C11H13NO2.ClH/c1-13-10-6-9-3-5-14-11(9)7-8(10)2-4-12;/h3,5-7H,2,4,12H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.8°C |
| Boiling Point: | 300.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6-(beta-Aminoethyl)-5-methoxybenzofuran hydrochloride , its cas register number is 28089-06-7. It also can be called 6-(2-Aminoethyl)-5-methoxybenzofuran, hydrochloride ; and Benzofuran, 6-(2-aminoethyl)-5-methoxy-, hydrochloride . Its classification code is Drug / Therapeutic Agent. |
| Flash Point: | 135.8°C |
| Safety Data | |
 |
|
