| Identification | |
| Name: | Carbonochloridothioicacid, O-ethyl ester |
| Synonyms: | Formic acid,chlorothio-, O-ethyl ester (6CI,7CI,8CI); Chlorothioformic acid O-ethyl ester;Ethoxythiocarbonyl chloride; O-Ethyl chlorothiocarbonate; O-Ethylchlorothioformate |
| CAS: | 2812-73-9 |
| Molecular Formula: | C3H5 Cl O S |
| Molecular Weight: | 124.59 |
| InChI: | InChI=1/C3H5ClOS.CHClOS/c1-3(5)6-2-4;2-1(3)4/h2H2,1H3;(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 39.3°C |
| Boiling Point: | 141.3°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Carbonochloridothioic acid, O-ethyl ester , its cas register number is 2812-73-9. It also can be called Diethyl midocarbonate ; and Ethyl chlorothioformate . |
| Flash Point: | 39.3°C |
| Safety Data | |
 |
|
