| Identification | |
| Name: | 9H-Purin-6-amine,2-iodo- |
| Synonyms: | Adenine,2-iodo- (6CI,7CI,8CI);2-Iodoadenine;2-Iodo-9H-purin-6-amine; |
| CAS: | 28128-26-9 |
| Molecular Formula: | C5H4IN5 |
| Molecular Weight: | 261.02 |
| InChI: | InChI=1/C5H4IN5/c6-5-10-3(7)2-4(11-5)9-1-8-2/h1H,(H3,7,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143 ºC |
| Boiling Point: | 312 ºC |
| Density: | 2.92 |
| Refractive index: | 1.918 |
| Specification: |
The 2-Iodoadenine with the cas number 28128-26-9 is also called 9H-Purin-6-amine,2-iodo-. The systematic name is 2-iodo-9H-purin-6-amine. Its molecular formula is C5H4IN5. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.97; (2)# of Rule of 5 Violations: 0 ; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 15; (6)ACD/KOC (pH 7.4): 15; (7)#H bond acceptors: 5; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 0; (10)Polar Surface Area: 80.48 Å2; (11)Index of Refraction: 1.918; (12)Molar Refractivity: 49.945 cm3; (13)Molar Volume: 105.896 cm3; (14)Polarizability: 19.8×10-24cm3; (15)Surface Tension: 125.725 dyne/cm. You can still convert the following datas into molecular structure: |
| Flash Point: | 143 ºC |
| Safety Data | |
 |
|
