| Identification |
| Name: | Piperazine,2,5-dimethyl-, (2R,5S)-rel- |
| Synonyms: | Piperazine,2,5-dimethyl-, trans- (8CI); (2R,5S)-2,5-Dimethylpiperazine; NSC 3708;meso-2,5-Dimethylpiperazine; trans-2,5-Dimethylpiperazine |
| CAS: | 2815-34-1 |
| EINECS: | 203-409-4 |
| Molecular Formula: | C6H14 N2 |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C6H14N2/c1-5-3-8-6(2)4-7-5/h5-8H,3-4H2,1-2H3/p+2/t5-,6-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2926 |
| Melting Point: | 113-118 ºC |
| Flash Point: | 72 ºC |
| Boiling Point: | 162-165 ºC |
| Density: | 0.53 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 50 G/100 ML (20 ºC) |
| Solubility: | 50 g/100 mL (20 ºC) in water |
| Appearance: | white to dark yellow crystalline powder or crystals |
| Packinggroup: | III |
| Flash Point: | 72 ºC |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F: Flammable
C: Corrosive
|
| |
 |
