| Identification | |
| Name: | Benzoselenazole,2-methyl- |
| Synonyms: | 2-Methylbenzoselenazole;NSC 379483 |
| CAS: | 2818-88-4 |
| EINECS: | 220-577-4 |
| Molecular Formula: | C8H7 N Se |
| Molecular Weight: | 196.12 |
| InChI: | InChI=1/C8H7NSe/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 28-30 ºC |
| Flash Point: | >230 °F |
| Boiling Point: | 140 ºC (51 mmHg) |
| Stability: | No data. |
| Refractive index: | n20/D 1.652(lit.) |
| Solubility: | Insoluble |
| Appearance: | Yellow solid. |
| Report: |
Selenium and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | >230 °F |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
