| Identification |
| Name: | Pyridine,3-[(2S)-1-methyl-2-pyrrolidinyl]-, 1-oxide |
| Synonyms: | NicotineN-oxide (6CI); Nicotine, 1-oxide (7CI,8CI); Pyridine,3-(1-methyl-2-pyrrolidinyl)-, 1-oxide, (S)-; Nicotine 1-N-oxide |
| CAS: | 2820-55-5 |
| Molecular Formula: | C10H14 N2 O |
| Molecular Weight: | 178.231 |
| InChI: | InChI=1/C10H14N2O/c1-11-6-3-5-10(11)9-4-2-7-12(13)8-9/h2,4,7-8,10H,3,5-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 164.2°C |
| Boiling Point: | 347.9°Cat760mmHg |
| Density: | 1.15g/cm3 |
| Stability: | Very Hygroscopic |
| Refractive index: | 1.589 |
| Flash Point: | 164.2°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: | Nicotine-1?N-oxide is a derivative of nicotine found in the leaves, stems, and roots of N. tabacum, N. affinis and N. sylvestris. Nicotine-1?N-oxide has also been identified as metabolites of nicotine in animals and in man. The metabolism of nico |
| Safety Data |
| |
 |
