Identification |
Name: | 2-Propenoic acid, 2-methyl-, polymer with 2-propenoic acid, sodium salt |
Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with 2-propenoic acid, sodium salt;2-METHYL 2-PROPENOIC ACID, POLYMER WITH 2-PROPENOIC ACID, SODIUM SALT;methyl acrylate/ acrylic acid copolymer, sodium salt |
CAS: | 28205-96-1 |
Molecular Formula: | C7H9NaO4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C4H6O2.C3H4O2.Na/c1-3(2)4(5)6;1-2-3(4)5;/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);/q;;+1/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 74.2°C |
Boiling Point: | 160.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 74.2°C |
Safety Data |
|
|