| Identification | |
| Name: | Phenol,2,3,4-trifluoro- |
| Synonyms: | 2,3,4-Trifluorophenol |
| CAS: | 2822-41-5 |
| Molecular Formula: | C6H3F3O |
| Molecular Weight: | 148.08 |
| InChI: | InChI=1/C6H3F3O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.46 |
| Refractive index: | 1.465 |
| Appearance: | colorless to slight yellow |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-36/37/39-45-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
