| Identification | |
| Name: | 2-Propanone,O-[(phenylamino)carbonyl]oxime |
| Synonyms: | Acetone,O-(phenylcarbamoyl)oxime (6CI,7CI,8CI); Acetone O-carbaniloyloxime; Acetoneoxime phenylurethane; NSC 5607; NSC 61379; O-(N-Phenylcarbamoyl) 2-propanoneoxime; O-(N-Phenylcarbamoyl)propanonoxime; Proximpham |
| CAS: | 2828-42-4 |
| EINECS: | 220-591-0 |
| Molecular Formula: | C10H12 N2 O2 |
| Molecular Weight: | 192.24 |
| InChI: | InChI=1/C10H12N2O2/c1-8(2)12-14-10(13)11-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,11,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.524 |
| Specification: |
Proximphan , its cas register number is 2828-42-4. It also can be called Acetone oxime N-phenylcarbamate ; Acetone, O-(phenylcarbamoyl)oxime (8CI) ; and O-(N-Fenylkarbamoyl)propanonoxim . |
| Flash Point: | °C |
| Safety Data | |
 |
|
