Identification |
Name: | 2-Propanone,O-[(phenylamino)carbonyl]oxime |
Synonyms: | Acetone,O-(phenylcarbamoyl)oxime (6CI,7CI,8CI); Acetone O-carbaniloyloxime; Acetoneoxime phenylurethane; NSC 5607; NSC 61379; O-(N-Phenylcarbamoyl) 2-propanoneoxime; O-(N-Phenylcarbamoyl)propanonoxime; Proximpham |
CAS: | 2828-42-4 |
EINECS: | 220-591-0 |
Molecular Formula: | C10H12 N2 O2 |
Molecular Weight: | 192.24 |
InChI: | InChI=1/C10H12N2O2/c1-8(2)12-14-10(13)11-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,11,13) |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.08g/cm3 |
Refractive index: | 1.524 |
Specification: |
Proximphan , its cas register number is 2828-42-4. It also can be called Acetone oxime N-phenylcarbamate ; Acetone, O-(phenylcarbamoyl)oxime (8CI) ; and O-(N-Fenylkarbamoyl)propanonoxim .
|
Flash Point: | °C |
Safety Data |
|
 |