| Identification | |
| Name: | Pyridine,1,2,3,6-tetrahydro-1-methyl-4-phenyl- |
| Synonyms: | 1,2,3,6-Tetrahydro-1-methyl-4-phenylpyridine;1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine; 1-Methyl-4-phenyl-1,2,5,6-tetrahydropyridine;MPTP; N-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine;N-Methyl-4-phenyl-1,2,5,6-tetrahydropyridine; NSC 139654 |
| CAS: | 28289-54-5 |
| EINECS: | 248-939-7 |
| Molecular Formula: | C12H15 N |
| Molecular Weight: | 173.28 |
| InChI: | InChI=1/C12H15N/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-7H,8-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | 105.8°C |
| Boiling Point: | 128-132 °C12 mm Hg(lit.) |
| Density: | 1.001g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.553 |
| Packinggroup: | III |
| Flash Point: | 105.8°C |
| Color: | Crystals from heptane |
| Usage: | A dopaminergic neurotoxin that reportedly causes a severe and irreversible Parkinsonian condition in humans and monkeys |
| Safety Data | |
| Hazard Symbols | |
 |
|
