| Identification | |
| Name: | Aminoguanidine sulfate |
| Synonyms: | carbazamidine sulphate;GUANIDINE,1-AMINO-,HYDROGENSULPHATE |
| CAS: | 2834-84-6 |
| EINECS: | 220-605-5 |
| Molecular Formula: | CH6N4 . H2O4S |
| Molecular Weight: | 172.16362 |
| InChI: | InChI=1/CH6N4.H2O4S/c2-1(3)5-4;1-5(2,3)4/h4H2,(H4,2,3,5);(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111.9°C |
| Boiling Point: | 261.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Aminoguanidine sulfate (CAS NO.2834-84-6) is also called carbazamidine sulphate ; Guanidine ,1-amino-, Hydrogensulphate . Aminoguanidine sulfate (CAS NO.2834-84-6) is high toxic. It is flammable. Aminoguanidine sulfate (CAS NO.2834-84-6) will produce toxic nitrogen oxide and sulfur oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 111.9°C |
| Safety Data | |
 |
|
