| Identification | |
| Name: | 6-Amino-m-cresol |
| Synonyms: | 2-Amino-5-methylphenol; 6-Amino-m-cresol (OH=1); 6-amino-meta-cresol |
| CAS: | 2835-98-5 |
| EINECS: | 220-620-7 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Flash Point: | 99.8 ºC |
| Boiling Point: | 241.4 ºCat 760 mmHg |
| Density: | 1.157 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Beige to Brown Crystalline Powder |
| Specification: | Beige to brown crystal powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29222900 |
| Flash Point: | 99.8 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
