| Identification | |
| Name: | Carbamo(dithioperox)imidicacid, phenylmethyl ester |
| Synonyms: | a-Toluenesulfenic acid, thio-,anhydrosulfide with 2-thiopseudourea (8CI); Pseudourea, 2-thio-, anhydrosulfidewith thio-a-toluenesulfenic acid;Benzenemethanesulfenothioic acid, anhydrosulfide with carbamimidothioic acid;Disulfide, amidino benzyl; Disulfide, aminoiminomethyl phenylmethyl;Pseudourea, anhydrosulfide with a-toluenesulfenic acid; S-Benzylthioisothiourea |
| CAS: | 28356-14-1 |
| Molecular Formula: | C8H10 N2 S2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H10N2S2/c9-8(10)12-11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155°C |
| Boiling Point: | 332.6°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.644 |
| Flash Point: | 155°C |
| Safety Data | |
 |
|
