| Identification |
| Name: | Phenol,3-amino-4-methyl- |
| Synonyms: | p-Cresol,3-amino- (6CI,7CI,8CI);3-Hydroxy-6-methylaniline;4-Methyl-3-aminophenol;3-Amino-4-methylphenol;2-Amino-4-hydroxytoluene;5-Hydroxy-2-methylaniline;5-Hydroxy-o-toluidine; |
| CAS: | 2836-00-2 |
| EINECS: | 220-622-8 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.157 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.616 |
| Appearance: | hite to light yellow crystal powder |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
