| Identification | |
| Name: | Benzoic acid,3-amino-4-methoxy- (9CI) |
| Synonyms: | p-Anisicacid, 3-amino- (7CI,8CI);4-Methoxy-3-aminobenzoic acid; |
| CAS: | 2840-26-8 |
| EINECS: | 220-634-3 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.303 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White to light yellow crystal powder |
| Specification: |
3-Amino-4-methoxybenzoic acid with CAS number of 2840-26-8 is also known as Labotest-bb lt01138583 ; 3-Amino-methoxy benzoic acid ; 3-Amino-p-anisic acid ; 3-Amino-4-anisic acid ; 3-Amino-4-methoxybenzoic acid ; 3-Amino-4-methoxy-benzoicaci ; kyselina3-amino-4-methoxybenzoova ; 3-Amino-4-methoxylbenzoic acid . If ingestion or inhalation,Get medical aid. Wash mouth out with water. Remove from exposure and move to fresh air immediately. If not breathing, give artificial respiration. If breathing is difficult, give oxygen. Get medical aid. As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. Use water spray, dry chemical, carbon dioxide, or chemical foam. Avoid contact with skin and eyes. Avoid ingestion and inhalation. Store in a cool, dry place. Store in a tightly closed container. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
