| Identification |
| Name: | 4H-Thiopyrano[4,3-d]pyrimidin-4-one,3,5,7,8-tetrahydro-2-methyl- |
| Synonyms: | 4H-Thiopyrano[4,3-d]pyrimidin-4-one,1,5,7,8-tetrahydro-2-methyl- (9CI); DR 2313 |
| CAS: | 284028-90-6 |
| Molecular Formula: | C8H10 N2 O S |
| Molecular Weight: | 182.2428 |
| InChI: | InChI=1/C8H10N2OS/c1-5-9-7-2-3-12-4-6(7)8(11)10-5/h2-4H2,1H3,(H,9,10,11) |
| Molecular Structure: |
![(C8H10N2OS) 4H-Thiopyrano[4,3-d]pyrimidin-4-one,1,5,7,8-tetrahydro-2-methyl- (9CI); DR 2313](https://img1.guidechem.com/chem/e/dict/6/284028-90-6.jpg) |
| Properties |
| Flash Point: | 165.036°C |
| Boiling Point: | 349.276°C at 760 mmHg |
| Density: | 1.463g/cm3 |
| Refractive index: | 1.714 |
| Biological Activity: | Potent, competitive inhibitor of poly(ADP-ribose) polymerase (PARP) (IC 50 values are 0.20 and 0.24 μ M for PARP-1 and PARP-2 respectively). Neuroprotective; reduces neuronal cell death in models of cerebral ischemia in vivo and in vitro . Brain penetrant. |
| Flash Point: | 165.036°C |
| Safety Data |
| |
 |
