| Identification | |
| Name: | 2-Propanol,trichloro-2-methyl- |
| Synonyms: | trichloro-2-methylpropan-2-ol |
| CAS: | 28471-22-9 |
| EINECS: | 249-042-3 |
| Molecular Formula: | C4H7 Cl3 O |
| Molecular Weight: | 177.45678 |
| InChI: | InChI=1/C2H8N2/c1-4(2)3/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 97 deg C |
| Flash Point: | 1.1°C |
| Boiling Point: | 63.9°Cat760mmHg |
| Density: | 0.829g/cm3 |
| Refractive index: | 1.426 |
| Solubility: | INSOL IN COLD WATER, SOL IN HOT WATER 1 G IN 125 ML WATER; SOL IN VOLATILE OILS Easily sol in hot water; one gram dissolves in 1 ml alcohol, 10 ml glycerol; sol in chloroform, ether, acetone, petr ether, glacial acetic acid, oils. Soluble in alcohol and glycerol, hot water, ether, chloroform, and volatile oils. Soluble in ethanol, ethyl ether, and acetone. In water, 8,000 mg/l @ 20 deg C |
| Flash Point: | 1.1°C |
| Color: | NEEDLES (WATER+1) Crystals COLORLESS TO WHITE Colorless to white crystals |
| Safety Data | |
 |
|
