| Identification | |
| Name: | Cyclopentene oxide |
| Synonyms: | 1,2-Epoxycyclopentane;Cyclopentane, 1,2-epoxy-;Cyclopentene epoxide;Epoxycyclopentane;NSC 148216;NSC 196230;cis-1,2-Epoxycyclopentane; |
| CAS: | 285-67-6 |
| EINECS: | 206-005-6 |
| Molecular Formula: | C5H8O |
| Molecular Weight: | 84.12 |
| InChI: | InChI=1/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.964 |
| Refractive index: | 1.433-1.435 |
| Appearance: | Clear colorless to very faintly yellow liquid |
| Specification: |
Cyclopentene oxide , its CAS NO. is 285-67-6, the synonyms are Cyclopentane, 1,2-epoxy- ; Cyclopentene epoxide ; Epoxycyclopentane ; cis-1,2-Epoxycyclopentane ; 1,2-Epoxycyclopentane ; 6-Oxabicyclo(3.1.0)hexane . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
