| Identification | |
| Name: | 1-Hexanamine,N-methyl-N-nitroso- |
| Synonyms: | Hexylamine,N-methyl-N-nitroso- (8CI); N-Nitroso-N-methylhexylamine;Nitrosomethylhexylamine |
| CAS: | 28538-70-7 |
| Molecular Formula: | C7H16 N2 O |
| Molecular Weight: | 144.25 |
| InChI: | InChI=1/C7H16N2O/c1-3-4-5-6-7-9(2)8-10/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 94.1°C |
| Boiling Point: | 232.1°Cat760mmHg |
| Density: | 0.92g/cm3 |
| Refractive index: | 1.454 |
| Specification: |
Nitrosomethyl-N-hexylamine , its cas register number is 28538-70-7. It also can be called N-Methyl-N-nitrosohexylaminee ; 1-Hexanamine, N-methyl-N-nitroso- ; and Hexylamine, N-methyl-N-nitroso- . |
| Flash Point: | 94.1°C |
| Safety Data | |
 |
|
