Identification |
Name: | 2-Propenoic acid, 2-methyl-, polymer with ethyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with ethyl 2-methyl-2-propenoate;ethyl methacrylate/ methacrylic acid polymer;Elvacite 2043 |
CAS: | 28572-98-7 |
Molecular Formula: | C10H16O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H10O2.C4H6O2/c1-4-8-6(7)5(2)3;1-3(2)4(5)6/h2,4H2,1,3H3;1H2,2H3,(H,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 120.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
 |