Identification |
Name: | Cyclohexene oxide |
Synonyms: | 7-Oxabicyclo[4.1.0]heptane; Epoxycyclohexane; Cyclohexane Oxide |
CAS: | 286-20-4 |
EINECS: | 206-007-7 |
Molecular Formula: | C6H10O |
Molecular Weight: | 98.14 |
InChI: | InChI=1/C6H10O/c1-2-4-6-5(3-1)7-6/h5-6H,1-4H2 |
Molecular Structure: |
![(C6H10O) 7-Oxabicyclo[4.1.0]heptane; Epoxycyclohexane; Cyclohexane Oxide](https://img.guidechem.com/casimg/286-20-4.gif) |
Properties |
Transport: | UN 2924 |
Density: | 0.97 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.452-1.454 |
Water Solubility: | INSOLUBLE |
Solubility: | Insoluble (soluble
in alcohol, ether and acetone) |
Appearance: | clear
colorless to yellow liquid |
Packinggroup: | II |
HS Code: | 29109000 |
Storage Temperature: | Flammables area |
Color: | COLORLESS LIQUID |
Usage: | Chemical intermediate. |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |