| Identification | |
| Name: | benzo-1,3-dioxole-5-acetic acid |
| Synonyms: | Aceticacid, [3,4-(methylenedioxy)phenyl]- (6CI,7CI,8CI); (1,3-Benzodioxol-5-yl)aceticacid; (3,4-Methylenedioxy)phenylacetic acid; (Benzodioxol-5-yl)acetic acid;2-(1,3-Benzodioxol-5-yl)acetic acid; 2-(3,4-Methylenedioxyphenyl)acetic acid;2-(Benzo[d][1,3]dioxol-5-yl)acetic acid; 3,4-(Methylenedioxy)benzene-1-aceticacid; Homopiperonylic acid; NSC 119057; NSC 14364; Piperonylacetic acid |
| CAS: | 2861-28-1 |
| EINECS: | 220-679-9 |
| Molecular Formula: | C9H8O4 |
| Molecular Weight: | 180.1574 |
| InChI: | InChI=1S/C9H8O4/c10-9(11)4-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5H2,(H,10,11) |
| Molecular Structure: | ![(C9H8O4) Aceticacid, [3,4-(methylenedioxy)phenyl]- (6CI,7CI,8CI); (1,3-Benzodioxol-5-yl)aceticacid; (3,4-Meth...](https://img1.guidechem.com/chem/e/dict/42/2861-28-1.jpg) |
| Properties | |
| Density: | 1.406 g/cm3 |
| Appearance: | beige to slight yellow Crystalline powder |
| Specification: | BEIGE TO PALE YELLOW MICRO-CRYSTALLINE POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
