Identification |
Name: | 10H-Phenoxarsine,10-chloro- |
Synonyms: | Phenoxarsine,10-chloro- (6CI,7CI,8CI); 10-Chloro-10H-phenoxarsine; 10-Chlorophenoxarsine;DID 95; NSC 16081 |
CAS: | 2865-70-5 |
EINECS: | 220-684-6 |
Molecular Formula: | C12H8 As Cl O |
Molecular Weight: | 278.57 |
InChI: | InChI=1/C12H8AsClO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
Molecular Structure: |
![(C12H8AsClO) Phenoxarsine,10-chloro- (6CI,7CI,8CI); 10-Chloro-10H-phenoxarsine; 10-Chlorophenoxarsine;DID 95; NSC...](https://img1.guidechem.com/chem/e/dict/32/2865-70-5.jpg) |
Properties |
Flash Point: | 174.8°C |
Boiling Point: | 365.1°Cat760mmHg |
Density: | g/cm3 |
Report: |
Reported in EPA TSCA Inventory. Arsenic and its compounds are on the Community Right-To-Know List.
|
Flash Point: | 174.8°C |
Safety Data |
|
![](/images/detail_15.png) |