| Identification | |
| Name: | 10H-Phenoxarsine,10-chloro- |
| Synonyms: | Phenoxarsine,10-chloro- (6CI,7CI,8CI); 10-Chloro-10H-phenoxarsine; 10-Chlorophenoxarsine;DID 95; NSC 16081 |
| CAS: | 2865-70-5 |
| EINECS: | 220-684-6 |
| Molecular Formula: | C12H8 As Cl O |
| Molecular Weight: | 278.57 |
| InChI: | InChI=1/C12H8AsClO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.8°C |
| Boiling Point: | 365.1°Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Reported in EPA TSCA Inventory. Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 174.8°C |
| Safety Data | |
 |
|
