Identification |
Name: | Propanoic acid,2-[[[(3-chlorophenyl)amino]carbonyl]oxy]- |
Synonyms: | Carbanilicacid, m-chloro-, ester with lactic acid (7CI,8CI); Lactic acid,m-chlorocarbanilate (6CI); 1-Carboxyethyl-1-N-(3-chlorophenyl)-carbamate; NSC73170 |
CAS: | 28705-92-2 |
Molecular Formula: | C10H10 Cl N O4 |
Molecular Weight: | 243.6437 |
InChI: | InChI=1/C10H10ClNO4/c1-6(9(13)14)16-10(15)12-8-4-2-3-7(11)5-8/h2-6H,1H3,(H,12,15)(H,13,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 166.4°C |
Boiling Point: | 351.5°Cat760mmHg |
Density: | 1.442g/cm3 |
Refractive index: | 1.602 |
Flash Point: | 166.4°C |
Safety Data |
|
 |