| Identification | |
| Name: | 9,10-Anthracenedione,1,4-difluoro- |
| Synonyms: | Anthraquinone,1,4-difluoro- (8CI); 1,4-Difluoro-9,10-anthraquinone;1,4-Difluoroanthracene-9,10-dione; 1,4-Difluoroanthraquinone |
| CAS: | 28736-42-7 |
| Molecular Formula: | C14H6 F2 O2 |
| Molecular Weight: | 244.19 |
| InChI: | InChI=1/C14H6F2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.8°C |
| Boiling Point: | 401.3°C at 760 mmHg |
| Density: | 1.457g/cm3 |
| Refractive index: | 1.617 |
| Specification: |
1,4-Difluoroanthraquinone , its cas register number is 28736-42-7. It also can be called 1,4-difluoro-9,10-dihydro-9,10-anthracenedione . 1,4-Difluoroanthraquinone (CAS NO.28736-42-7) is harmful by inhalation, in contact with skin and if swallowed and it's irritating to eyes, respiratory system and skin. And it may cause sensitization by skin contact. |
| Flash Point: | 152.8°C |
| Safety Data | |
 |
|
