| Identification | |
| Name: | Benzene,tetrachloronitro- (6CI,7CI,9CI) |
| Synonyms: | Tetrachloronitrobenzene |
| CAS: | 28804-67-3 |
| EINECS: | 249-239-4 |
| Molecular Formula: | C6H Cl4 N O2 |
| Molecular Weight: | 368.3385 |
| InChI: | InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 99.5 deg C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.8g/cm3 |
| Solubility: | READILY SOL IN CARBON DISULFIDE Soluble in ethanol, benzene, and chloroform In ethanol about 40 mg/L (25 deg C) /Tecnazene/ is readily soluble in ... ketones, and aromatic and chlorinated hydrocarbon compounds. It is practically insoluble in water (0.44 mg/l at 20 deg C) ... In water, 2.09 mg/L at 25 deg C |
| Flash Point: | °C |
| Color: | Colorless crystals |
| Safety Data | |
 |
|
