| Identification | |
| Name: | 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrahydro-2-methyl- |
| Synonyms: | 1-Cyclohexene-1,2-dicarboximide,N-methyl- (8CI) |
| CAS: | 28839-49-8 |
| Molecular Formula: | C9H11 N O2 |
| Molecular Weight: | 165.21 |
| InChI: | InChI=1/C9H11NO2/c1-10-8(11)6-4-2-3-5-7(6)9(10)12/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 133.6°C |
| Boiling Point: | 293.7°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.558 |
| Specification: |
N-Methyl-3,4,5,6-tetrahydrophthalimide , its cas register number is 28839-49-8. It also can be called 1-Cyclohexene-1,2-dicarboximide, N-methyl- ; N-Methyl-1-cyclophene-1,2-dicarboximide ; and Phthalimide, 3,4,5,6-tetrahydro-N-methyl- . |
| Flash Point: | 133.6°C |
| Safety Data | |
 |
|
