Identification |
Name: | Acridine,9-(2,2-dimethylhydrazinyl)- |
Synonyms: | Acridine,9-(2,2-dimethylhydrazino)- (8CI,9CI) |
CAS: | 28846-35-7 |
Molecular Formula: | C15H15 N3 |
Molecular Weight: | 237.33 |
InChI: | InChI=1/C15H15N3/c1-18(2)17-15-11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10H,1-2H3,(H,16,17) |
Molecular Structure: |
|
Properties |
Flash Point: | 200.7°C |
Boiling Point: | 408.3°C at 760 mmHg |
Density: | 1.222g/cm3 |
Refractive index: | 1.736 |
Specification: |
9-(2,2-Dimethylhydrazino)acridine , its cas register number is 28846-35-7. It also can be called Acridine, 9-(2,2-dimethylhydrazino)- ; LS-14362 ; and CID121004 .
|
Flash Point: | 200.7°C |
Safety Data |
Hazard Symbols |
|
|
|