| Identification | |
| Name: | 2H-1,4-Benzodiazepin-2-one,7-chloro-5-(2-fluorophenyl)-1,3-dihydro- |
| Synonyms: | 2H-1,4-Benzodiazepin-2-one,7-chloro-5-(o-fluorophenyl)-1,3-dihydro- (7CI,8CI);7-Chloro-1,3-dihydro-5-(2'-fluorophenyl)-2H-1,4-benzodiazapin-2-one;7-Chloro-5-(2'-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one;7-Chloro-5-(o-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one;7-Chloro-5-(o-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepine-2-one;CM 7116;Descarbethoxyloflazepate;N-1-Desalkylflurazepam;N-Desalkyl-2-oxoquazepam;N-Desalkylflutoprazepam;Norfludiazepam;Norflurazepam;Norflutoprazepam;Ro 5-3367;Sch 17514; |
| CAS: | 2886-65-9 |
| EINECS: | 220-748-3 |
| Molecular Formula: | C15H10ClFN2O |
| Molecular Weight: | 288.71 |
| InChI: | InChI=1/C15H10ClFN2O/c16-9-5-6-13-11(7-9)15(18-8-14(20)19-13)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 228.4°C |
| Boiling Point: | 454°C at 760 mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.647 |
| Appearance: | Light yellow solid |
| Specification: |
2H-1,4-Benzodiazepin-2-one,7-chloro-5-(2-fluorophenyl)-1,3-dihydro- , with CAS number of 2886-65-9, can be called Dealkylflurazepam ; Descarbethoxyloflazepate ; Flurazepam M (des-alkyl) ; Flurazepam M (N-1-des-alkyl) ; Flurazepam, des-alkyl ; N-1-desalkyl-flurazepam ; N-Desalkyl-2-oxoquazepam ; N-Desalkylflurazepam . 2H-1,4-Benzodiazepin-2-one,7-chloro-5-(2-fluorophenyl)-1,3-dihydro- (CAS NO.2886-65-9) is a light yellow solid,this is a controlled drug precursor therefore a liscence may be required for purchase. |
| Flash Point: | 228.4°C |
| Usage: | The major human metabolite of flurazepam. This is a controlled drug precursor therefore a liscence may be required for purchase |
| Safety Data | |
 |
|
