| Identification |
| Name: | D-glycero-D-galacto-Nononicacid, 2,3-dideoxy-2-methylene-, g-lactone (9CI) |
| Synonyms: | 2,3-Dideoxy-2-methylene-D-glycero-D-galacto-nononic Acid -Lactone |
| CAS: | 289697-66-1 |
| Molecular Formula: | C10H16 O7 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H16O7/c1-4-2-6(17-10(4)16)8(14)9(15)7(13)5(12)3-11/h5-9,11-15H,1-3H2/t5-,6+,7-,8-,9+/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 260.466°C |
| Boiling Point: | 658.494°C at 760 mmHg |
| Density: | 1.509g/cm3 |
| Refractive index: | 1.587 |
| Flash Point: | 260.466°C |
| Usage: | Intermediate for the synthesis of KDN and other sialic acids. |
| Safety Data |
| |
 |
