| Identification | |
| Name: | Alanine,3,3'-diselenobis- |
| Synonyms: | Alanine,3,3'-diselenodi-, DL- (8CI); DL-Alanine, 3,3'-diselenobis-; DL-Selenocystine;Seleno-DL-cystine; Selenocystine |
| CAS: | 2897-21-4 |
| Molecular Formula: | C6H12 N2 O4 Se2 |
| Molecular Weight: | 334.12 |
| InChI: | InChI=1/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 279.3°C |
| Boiling Point: | 538.3°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Now, DL-Selenocystine , ever using cas register number: 1464-43-3, its cas register number is 2897-21-4. It also can be called Alanine, 3,3'-diselenodi-, DL- ; and Seleno-DL-cystine . |
| Packinggroup: | II |
| Flash Point: | 279.3°C |
| Storage Temperature: | −20°C |
| Color: | yellow to brown |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
