Identification |
Name: | Phenylalanine,N-benzoyl- |
Synonyms: | Alanine,N-benzoyl-3-phenyl-, DL- (7CI,8CI);DL-Phenylalanine, N-benzoyl-;DL-2-Benzamido-3-phenylpropionic acid;DL-Bz-Phenylalanine;DL-N-Benzoylphenylalanine;N-Benzoyl-DL-phenylalanine;NSC 96354;N-benzoylphenylalanine;N-Benzoyl-DL-phenylalanine;N-Benzoylphenylalanine;Phenylalanine, N-benzoyl-; |
CAS: | 2901-76-0 |
Molecular Formula: | C16H15NO3 |
Molecular Weight: | 269.3 |
InChI: | InChI=1/C16H15NO3/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,18)(H,19,20)/p-1/t14-/m1/s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 187°C |
Flash Point: | 275.5°C |
Boiling Point: | 532°C at 760 mmHg |
Density: | 1.232 g/cm3 |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 275.5°C |
Safety Data |
|
 |