Identification |
Name: | Butanoic acid,4-cyanophenyl ester |
Synonyms: | Butyricacid, ester with p-hydroxybenzonitrile (8CI); Benzonitrile, p-hydroxy-,butyrate (ester) (8CI) |
CAS: | 29052-10-6 |
EINECS: | 249-389-0 |
Molecular Formula: | C11H11 N O2 |
Molecular Weight: | 189.2105 |
InChI: | InChI=1/C11H11NO2/c1-2-3-11(13)14-10-6-4-9(8-12)5-7-10/h4-7H,2-3H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 144.1°C |
Boiling Point: | 309.7°Cat760mmHg |
Density: | 1.11g/cm3 |
Refractive index: | 1.523 |
Flash Point: | 144.1°C |
Safety Data |
|
 |