| Identification | |
| Name: | Benzoic acid, 4-amino-,ion(1-) |
| Synonyms: | Benzoicacid, p-amino-, ion(1-) (8CI); 4-Aminobenzoate; 4-Aminobenzoate ion;4-Aminobenzoic acid, ion(1-); p-Aminobenzoate; p-Aminobenzoate anion;p-Aminobenzoic acid anion |
| CAS: | 2906-28-7 |
| Molecular Formula: | C7H6 N O2 |
| Molecular Weight: | 137.136 |
| InChI: | InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 188.5 deg C |
| Flash Point: | 159.4°C |
| Boiling Point: | 339.9°Cat760mmHg |
| Density: | 1.315g/cm3 |
| Solubility: | One gram dissolves in 90 ml boiling water; in 8 ml alcohol, in 60 ml ether. Sol in ethyl acetate, glacial acetic acid; slightly sol in benzene; practically insol in petroleum ether. Freely soluble in alcohol. Soluble in alkalis and ethane (C2H6) Insoluble in chloroform Soluble in oxygenated solvents Slightly soluble in acetone In water, 6,110 mg/liter @ 30 deg C |
| Flash Point: | 159.4°C |
| Color: | Monoclinic prisms from dilute alcohol Light buff crystals; white when pure Yellowish to red crystals or prisms White or slightly yellow crystals or crystalline powder |
| Safety Data | |
 |
|
