Identification |
Name: | 10H-Phenothiazine-10-carbothioicacid, anhydrosulfide with 4-methyl-1-piperazinecarbodithioic acid |
Synonyms: | Phenothiazine-10-carbothioicacid, anhydrosulfide with 4-methyl-1-piperazinecarbodithioic acid (8CI);1-Piperazinecarbodithioic acid, 4-methyl-, anhydrosulfide withphenothiazine-10-carbothioic acid (8CI) |
CAS: | 29140-79-2 |
Molecular Formula: | C19H19 N3 O S3 |
Molecular Weight: | 401.5687 |
InChI: | InChI=1/C19H19N3OS3/c1-20-10-12-21(13-11-20)19(24)26-18(23)22-14-6-2-4-8-16(14)25-17-9-5-3-7-15(17)22/h2-9H,10-13H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 278.8°C |
Boiling Point: | 537.4°Cat760mmHg |
Density: | 1.394g/cm3 |
Refractive index: | 1.718 |
Flash Point: | 278.8°C |
Safety Data |
|
 |