| Identification |
| Name: | 4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid - ethyl piperazin-1-ylacetate (1:1) |
| Synonyms: | 4-(Dithiocarboxy)-1-piperazineacetic acid 1-ethyl ester compd. with ethyl 1-piperazineacetate;1-Piperazineacetic acid, 4-(dithiocarboxy)-, 1-ethyl ester, compd. with ethyl 1-piperazineacetate (1:1);29140-80-5;AC1L4HZ8;LS-110047;4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid - ethyl piperazin-1-ylacetate (1:1);4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid; ethyl 2-piperazin-1-ylacetate |
| CAS: | 29140-80-5 |
| Molecular Formula: | C17H32N4O4S2 |
| Molecular Weight: | 420.5904 |
| InChI: | InChI=1/C9H16N2O2S2.C8H16N2O2/c1-2-13-8(12)7-10-3-5-11(6-4-10)9(14)15;1-2-12-8(11)7-10-5-3-9-4-6-10/h2-7H2,1H3,(H,14,15);9H,2-7H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.5°C |
| Boiling Point: | 330.2°C at 760 mmHg |
| Flash Point: | 153.5°C |
| Safety Data |
| |
 |
