| Identification | |
| Name: | Benzenamine,ar-methoxy- |
| Synonyms: | Anisidine,isomers (8CI); (Methoxyphenyl)amine; Anisidine; Methoxyaniline |
| CAS: | 29191-52-4 |
| EINECS: | 249-496-2 |
| Molecular Formula: | C7H9 N O |
| Molecular Weight: | 123.15246 |
| InChI: | InChI=1/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 5 deg C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | MISCIBLE WITH ETHANOL, BENZENE, DIETHYL ETHER AND ACETONE Sol in dilute mineral acid 1.3 g/100 g water Water solubility of 1.4X10+4 mg/l at 25 deg C |
| Flash Point: | °C |
| Color: | PALE YELLOWISH LIQUID Reddish or yellowish colored oil Colorless to pink liquid Red to yellow, oily liquid [Note: A solid below 41 degrees F]. |
| Safety Data | |
 |
|
