| Identification |
| Name: | Acetic acid,2-(tetradecylthio)- |
| Synonyms: | Aceticacid, (tetradecylthio)- (8CI,9CI);1-Mono(carboxymethylthio)tetradecane; |
| CAS: | 2921-20-2 |
| Molecular Formula: | C16H32O2S |
| Molecular Weight: | 288.49 |
| InChI: | InChI=1/C16H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 197.3 ºC |
| Boiling Point: | 402.6ºC at 760 mmHg |
| Density: | 0.957 g/cm3 |
| Refractive index: | 1.481 |
| Solubility: | 402.6ºC at 760 mmHg |
| Appearance: | white |
| Flash Point: | 197.3 ºC |
| Color: | white |
| Usage: | TTA is a novel thio-fatty acid which cannot undergo beta-oxidation. It induces apoptosis in IPC-81 leukemia cells via depolarization of mitochondrial membrane potential and inhibits glioma cell proliferation. TTA completely prevents high fat diet- |
| Safety Data |
| |
 |
