| Identification | |
| Name: | Phenylalanine, 4-amino- |
| Synonyms: | Alanine,3-(p-aminophenyl)-, DL- (8CI); DL-Phenylalanine, 4-amino-;4-Amino-DL-phenylalanine; DL-4-Aminophenylalanine; DL-p-Aminophenylalanine; NSC21918; NSC 29446; p-Amino-DL-phenylalanine |
| CAS: | 2922-41-0 |
| EINECS: | 220-869-1 |
| Molecular Formula: | C9H12 N2 O2 |
| Molecular Weight: | 180.2038 |
| InChI: | InChI=1/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 255-258 °C (dec.)(lit.) |
| Flash Point: | 185.8°C |
| Boiling Point: | 383.5°Cat760mmHg |
| Density: | 1.289g/cm3 |
| Refractive index: | 1.63 |
| Specification: |
Phenylalanine, 4-amino- with cas registry number of 2922-41-0 is called p-Amino-DL-phenylalanine hydrate with chemical properties of white powder. |
| Flash Point: | 185.8°C |
| Storage Temperature: | -15°C |
| Safety Data | |
 |
|
