| Identification | |
| Name: | 3,4-Difluorotoluene |
| Synonyms: | 3,4-Difluoromethylbenzene;1,2-Difluor-4-methylbenzol; |
| CAS: | 2927-34-6 |
| Molecular Formula: | C7H6F2 |
| Molecular Weight: | 128.12 |
| InChI: | InChI=1/C7H6F2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.12 |
| Refractive index: | 1.449-1.451 |
| Appearance: | colorless to light yellow liquid |
| Specification: |
3,4-Difluorotoluene (CAS NO.2927-34-6) is also named as 1,2-Difluor-4-methylbenzol ; 1,2-Difluoro-4-methylbenzene ; Benzene, 1,2-difluoro-4-methyl- ; 3,4-Difluoromethylbenzene . 3,4-Difluorotoluene (CAS NO.2927-34-6) is colorless to light yellow liquid. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
